C17H18BrNO5 — CID 119369410
(2R)-2-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 119369410) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119369410 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | (2R)-2-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(COc2ccc(Br)cc2)o1)C(=O)O |
| InChI | InChI=1S/C17H18BrNO5/c1-10(2)15(17(21)22)19-16(20)14-8-7-13(24-14)9-23-12-5-3-11(18)4-6-12/h3-8,10,15H,9H2,1-2H3,(H,19,20)(H,21,22)/t15-/m1/s1 |
| InChIKey | GVAFAWYAKDBZHS-OAHLLOKOSA-N |
| XLogP | 3.46 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |