C19H20BrNO5 — CID 55775432
methyl 1-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]cyclopentane-1-carboxylate (PubChem CID 55775432) has the molecular formula C19H20BrNO5 and a molecular weight of 422.28 g/mol. Its IUPAC name is methyl 1-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 55775432 |
| Molecular Formula | C19H20BrNO5 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | methyl 1-[[5-[(4-bromophenoxy)methyl]furan-2-carbonyl]amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccc(COc3ccc(Br)cc3)o2)CCCC1 |
| InChI | InChI=1S/C19H20BrNO5/c1-24-18(23)19(10-2-3-11-19)21-17(22)16-9-8-15(26-16)12-25-14-6-4-13(20)5-7-14/h4-9H,2-3,10-12H2,1H3,(H,21,22) |
| InChIKey | ZPXIGEYOZZTNFL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |