C17H18BrNO4 — CID 38939482
methyl 1-[(7-bromo-1-benzofuran-2-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 38939482) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is methyl 1-[(7-bromo-1-benzofuran-2-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(7-bromo-1-benzofuran-2-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 38939482 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | methyl 1-[(7-bromo-1-benzofuran-2-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2cc3cccc(Br)c3o2)CCCCC1 |
| InChI | InChI=1S/C17H18BrNO4/c1-22-16(21)17(8-3-2-4-9-17)19-15(20)13-10-11-6-5-7-12(18)14(11)23-13/h5-7,10H,2-4,8-9H2,1H3,(H,19,20) |
| InChIKey | ZSRMHHRUFJGIBF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |