C16H18BrNO2 — CID 38911138
7-bromo-N-(4-methylcyclohexyl)-1-benzofuran-2-carboxamide (PubChem CID 38911138) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 7-bromo-N-(4-methylcyclohexyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-(4-methylcyclohexyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 38911138 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 7-bromo-N-(4-methylcyclohexyl)-1-benzofuran-2-carboxamide |
| SMILES | CC1CCC(NC(=O)c2cc3cccc(Br)c3o2)CC1 |
| InChI | InChI=1S/C16H18BrNO2/c1-10-5-7-12(8-6-10)18-16(19)14-9-11-3-2-4-13(17)15(11)20-14/h2-4,9-10,12H,5-8H2,1H3,(H,18,19) |
| InChIKey | VWJVFNUHZLRQEX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |