About 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide
7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide (PubChem CID 111696730) has the molecular formula C15H14BrNO3
and a molecular weight of 336.19 g/mol. Its IUPAC name is 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide |
| PubChem CID | 111696730 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C15H14BrNO3/c16-12-3-1-2-10-7-13(20-14(10)12)15(19)17-11-5-4-9(6-11)8-18/h1-5,7,9,11,18H,6,8H2,(H,17,19)/t9-,11+/m0/s1 |
| InChIKey | FSBYEQGINNBUMA-GXSJLCMTSA-N |
| XLogP | 2.86 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide?
The IUPAC name of 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide (CID 111696730) is 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide.
What is the SMILES notation for 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide?
The canonical SMILES for 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide is O=C(N[C@@H]1C=C[C@H](CO)C1)c1cc2cccc(Br)c2o1.
What is the InChIKey of 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide?
The InChIKey is FSBYEQGINNBUMA-GXSJLCMTSA-N. The full InChI is InChI=1S/C15H14BrNO3/c16-12-3-1-2-10-7-13(20-14(10)12)15(19)17-11-5-4-9(6-11)8-18/h1-5,7,9,11,18H,6,8H2,(H,17,19)/t9-,11+/m0/s1.
What are the key properties of 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide?
7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide has a molecular weight of 336.19 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide is sourced from PubChem (CID 111696730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).