C15H14BrNO3 — CID 111696730
7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide (PubChem CID 111696730) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111696730 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 7-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C15H14BrNO3/c16-12-3-1-2-10-7-13(20-14(10)12)15(19)17-11-5-4-9(6-11)8-18/h1-5,7,9,11,18H,6,8H2,(H,17,19)/t9-,11+/m0/s1 |
| InChIKey | FSBYEQGINNBUMA-GXSJLCMTSA-N |
| XLogP | 2.86 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|