C11H12BrNO3 — CID 111661261
5-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide (PubChem CID 111661261) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 5-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111661261 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 5-bromo-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H12BrNO3/c12-10-4-3-9(16-10)11(15)13-8-2-1-7(5-8)6-14/h1-4,7-8,14H,5-6H2,(H,13,15)/t7-,8+/m0/s1 |
| InChIKey | KEVNKNMIRVSSEG-JGVFFNPUSA-N |
| XLogP | 1.71 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|