C21H23NO2 — CID 111696706
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-phenylethyl)benzamide (PubChem CID 111696706) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 111696706 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-phenylethyl)benzamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c23-15-17-11-13-19(14-17)22-21(24)20-9-5-4-8-18(20)12-10-16-6-2-1-3-7-16/h1-9,11,13,17,19,23H,10,12,14-15H2,(H,22,24)/t17-,19+/m0/s1 |
| InChIKey | JXEKKSVDGDIRMV-PKOBYXMFSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|