C17H16ClNO3 — CID 111860717
4-chloro-1-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]naphthalene-2-carboxamide (PubChem CID 111860717) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is 4-chloro-1-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]naphthalene-2-carboxamide.
| Compound Name | 4-chloro-1-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 111860717 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-chloro-1-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]naphthalene-2-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cc(Cl)c2ccccc2c1O |
| InChI | InChI=1S/C17H16ClNO3/c18-15-8-14(16(21)13-4-2-1-3-12(13)15)17(22)19-11-6-5-10(7-11)9-20/h1-6,8,10-11,20-21H,7,9H2,(H,19,22)/t10-,11+/m0/s1 |
| InChIKey | RFERCZPNDRJESN-WDEREUQCSA-N |
| XLogP | 2.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|