C20H23N3O2 — CID 111661790
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-pyrrolidin-1-ylquinoline-3-carboxamide (PubChem CID 111661790) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-pyrrolidin-1-ylquinoline-3-carboxamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 111661790 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C20H23N3O2/c24-13-14-7-8-16(11-14)21-20(25)17-12-15-5-1-2-6-18(15)22-19(17)23-9-3-4-10-23/h1-2,5-8,12,14,16,24H,3-4,9-11,13H2,(H,21,25)/t14-,16+/m0/s1 |
| InChIKey | WAPPVSRIWMOCOX-GOEBONIOSA-N |
| XLogP | 2.50 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|