C21H27N3O — CID 52515339
N-[(1S,2S)-2-methylcyclohexyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide (PubChem CID 52515339) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 52515339 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C21H27N3O/c1-15-8-2-4-10-18(15)23-21(25)17-14-16-9-3-5-11-19(16)22-20(17)24-12-6-7-13-24/h3,5,9,11,14-15,18H,2,4,6-8,10,12-13H2,1H3,(H,23,25)/t15-,18-/m0/s1 |
| InChIKey | CANUIGALHIAZRZ-YJBOKZPZSA-N |
| XLogP | 4.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |