C25H29N5O2 — CID 86886621
N-[4-[3-(dimethylamino)propanoylamino]phenyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide (PubChem CID 86886621) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propanoylamino]phenyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide.
| Compound Name | N-[4-[3-(dimethylamino)propanoylamino]phenyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 86886621 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N-[4-[3-(dimethylamino)propanoylamino]phenyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
| SMILES | CN(C)CCC(=O)Nc1ccc(NC(=O)c2cc3ccccc3nc2N2CCCC2)cc1 |
| InChI | InChI=1S/C25H29N5O2/c1-29(2)16-13-23(31)26-19-9-11-20(12-10-19)27-25(32)21-17-18-7-3-4-8-22(18)28-24(21)30-14-5-6-15-30/h3-4,7-12,17H,5-6,13-16H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | SRROKWZQTRQJCI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |