C24H28N4O — CID 56516472
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-pyrrolidin-1-ylquinoline-3-carboxamide (PubChem CID 56516472) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-pyrrolidin-1-ylquinoline-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-pyrrolidin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 56516472 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-pyrrolidin-1-ylquinoline-3-carboxamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)c1cc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C24H28N4O/c1-26(2)20-12-10-18(11-13-20)17-27(3)24(29)21-16-19-8-4-5-9-22(19)25-23(21)28-14-6-7-15-28/h4-5,8-13,16H,6-7,14-15,17H2,1-3H3 |
| InChIKey | GMUASCDGICZWDR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|