C23H23F2N3O3S — CID 169263976
2-(4,4-difluoroazepan-1-yl)-N-(3-methylsulfonylphenyl)quinoline-3-carboxamide (PubChem CID 169263976) has the molecular formula C23H23F2N3O3S and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-(4,4-difluoroazepan-1-yl)-N-(3-methylsulfonylphenyl)quinoline-3-carboxamide.
| Compound Name | 2-(4,4-difluoroazepan-1-yl)-N-(3-methylsulfonylphenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 169263976 |
| Molecular Formula | C23H23F2N3O3S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-(4,4-difluoroazepan-1-yl)-N-(3-methylsulfonylphenyl)quinoline-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cc3ccccc3nc2N2CCCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C23H23F2N3O3S/c1-32(30,31)18-8-4-7-17(15-18)26-22(29)19-14-16-6-2-3-9-20(16)27-21(19)28-12-5-10-23(24,25)11-13-28/h2-4,6-9,14-15H,5,10-13H2,1H3,(H,26,29) |
| InChIKey | VKDZCGBPBMSTRQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |