C24H30F2N4O3S — CID 169264491
2-(4,4-difluoroazepan-1-yl)-N-(3-sulfamoylphenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 169264491) has the molecular formula C24H30F2N4O3S and a molecular weight of 492.59 g/mol. Its IUPAC name is 2-(4,4-difluoroazepan-1-yl)-N-(3-sulfamoylphenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | 2-(4,4-difluoroazepan-1-yl)-N-(3-sulfamoylphenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169264491 |
| Molecular Formula | C24H30F2N4O3S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-(4,4-difluoroazepan-1-yl)-N-(3-sulfamoylphenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2cc3c(nc2N2CCCC(F)(F)CC2)CCCCCC3)c1 |
| InChI | InChI=1S/C24H30F2N4O3S/c25-24(26)11-6-13-30(14-12-24)22-20(15-17-7-3-1-2-4-10-21(17)29-22)23(31)28-18-8-5-9-19(16-18)34(27,32)33/h5,8-9,15-16H,1-4,6-7,10-14H2,(H,28,31)(H2,27,32,33) |
| InChIKey | ZLEDFYWRECPONR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |