C23H28F2N4O2S — CID 169124179
6-but-3-enyl-2-(4,4-difluoroazepan-1-yl)-N-[3-(methylsulfonimidoyl)phenyl]pyridine-3-carboxamide (PubChem CID 169124179) has the molecular formula C23H28F2N4O2S and a molecular weight of 462.57 g/mol. Its IUPAC name is 6-but-3-enyl-2-(4,4-difluoroazepan-1-yl)-N-[3-(methylsulfonimidoyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-but-3-enyl-2-(4,4-difluoroazepan-1-yl)-N-[3-(methylsulfonimidoyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169124179 |
| Molecular Formula | C23H28F2N4O2S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 6-but-3-enyl-2-(4,4-difluoroazepan-1-yl)-N-[3-(methylsulfonimidoyl)phenyl]pyridine-3-carboxamide |
| SMILES | [H]N=[S@](C)(=O)c1cccc(NC(=O)c2ccc(CCC=C)nc2N2CCCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C23H28F2N4O2S/c1-3-4-7-17-10-11-20(21(27-17)29-14-6-12-23(24,25)13-15-29)22(30)28-18-8-5-9-19(16-18)32(2,26)31/h3,5,8-11,16,26H,1,4,6-7,12-15H2,2H3,(H,28,30)/t32-/m1/s1 |
| InChIKey | CGUBRCASPASOOQ-JGCGQSQUSA-N |
| XLogP | 5.11 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|