C23H29F2N3OS — CID 176694719
6-(cyclopropylmethyl)-2-(4,4-difluoroazepan-1-yl)-N-phenylpyridine-3-carboxamide;methanethiol (PubChem CID 176694719) has the molecular formula C23H29F2N3OS and a molecular weight of 433.57 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-2-(4,4-difluoroazepan-1-yl)-N-phenylpyridine-3-carboxamide;methanethiol.
| Compound Name | 6-(cyclopropylmethyl)-2-(4,4-difluoroazepan-1-yl)-N-phenylpyridine-3-carboxamide;methanethiol |
|---|---|
| PubChem CID | 176694719 |
| Molecular Formula | C23H29F2N3OS |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 6-(cyclopropylmethyl)-2-(4,4-difluoroazepan-1-yl)-N-phenylpyridine-3-carboxamide;methanethiol |
| SMILES | CS.O=C(Nc1ccccc1)c1ccc(CC2CC2)nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C22H25F2N3O.CH4S/c23-22(24)11-4-13-27(14-12-22)20-19(10-9-18(25-20)15-16-7-8-16)21(28)26-17-5-2-1-3-6-17;1-2/h1-3,5-6,9-10,16H,4,7-8,11-15H2,(H,26,28);2H,1H3 |
| InChIKey | RJBWSXIVAYLDSJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|