C25H28F2N4OS — CID 169124937
3-(4,4-difluoroazepan-1-yl)-5-methyl-N,6-diphenylpyridazine-4-carboxamide;methanethiol (PubChem CID 169124937) has the molecular formula C25H28F2N4OS and a molecular weight of 470.59 g/mol. Its IUPAC name is 3-(4,4-difluoroazepan-1-yl)-5-methyl-N,6-diphenylpyridazine-4-carboxamide;methanethiol.
| Compound Name | 3-(4,4-difluoroazepan-1-yl)-5-methyl-N,6-diphenylpyridazine-4-carboxamide;methanethiol |
|---|---|
| PubChem CID | 169124937 |
| Molecular Formula | C25H28F2N4OS |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 3-(4,4-difluoroazepan-1-yl)-5-methyl-N,6-diphenylpyridazine-4-carboxamide;methanethiol |
| SMILES | CS.Cc1c(-c2ccccc2)nnc(N2CCCC(F)(F)CC2)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H24F2N4O.CH4S/c1-17-20(23(31)27-19-11-6-3-7-12-19)22(30-15-8-13-24(25,26)14-16-30)29-28-21(17)18-9-4-2-5-10-18;1-2/h2-7,9-12H,8,13-16H2,1H3,(H,27,31);2H,1H3 |
| InChIKey | RMGPQPCLZZUTJB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|