C23H24F2N4O4S — CID 169264344
2-(4,4-difluoroazepan-1-yl)-7-methoxy-N-(3-sulfamoylphenyl)quinoline-3-carboxamide (PubChem CID 169264344) has the molecular formula C23H24F2N4O4S and a molecular weight of 490.53 g/mol. Its IUPAC name is 2-(4,4-difluoroazepan-1-yl)-7-methoxy-N-(3-sulfamoylphenyl)quinoline-3-carboxamide.
| Compound Name | 2-(4,4-difluoroazepan-1-yl)-7-methoxy-N-(3-sulfamoylphenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 169264344 |
| Molecular Formula | C23H24F2N4O4S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-(4,4-difluoroazepan-1-yl)-7-methoxy-N-(3-sulfamoylphenyl)quinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)Nc3cccc(S(N)(=O)=O)c3)c(N3CCCC(F)(F)CC3)nc2c1 |
| InChI | InChI=1S/C23H24F2N4O4S/c1-33-17-7-6-15-12-19(22(30)27-16-4-2-5-18(13-16)34(26,31)32)21(28-20(15)14-17)29-10-3-8-23(24,25)9-11-29/h2,4-7,12-14H,3,8-11H2,1H3,(H,27,30)(H2,26,31,32) |
| InChIKey | FYNSTXMOIOUDGF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |