C22H29N5O4S — CID 56515869
(4-morpholin-4-ylsulfonylpiperazin-1-yl)-(2-pyrrolidin-1-ylquinolin-3-yl)methanone (PubChem CID 56515869) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is (4-morpholin-4-ylsulfonylpiperazin-1-yl)-(2-pyrrolidin-1-ylquinolin-3-yl)methanone.
| Compound Name | (4-morpholin-4-ylsulfonylpiperazin-1-yl)-(2-pyrrolidin-1-ylquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 56515869 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (4-morpholin-4-ylsulfonylpiperazin-1-yl)-(2-pyrrolidin-1-ylquinolin-3-yl)methanone |
| SMILES | O=C(c1cc2ccccc2nc1N1CCCC1)N1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H29N5O4S/c28-22(25-9-11-26(12-10-25)32(29,30)27-13-15-31-16-14-27)19-17-18-5-1-2-6-20(18)23-21(19)24-7-3-4-8-24/h1-2,5-6,17H,3-4,7-16H2 |
| InChIKey | SPYSCEAAUZUABT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 86.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |