C19H23FN4O4S — CID 46978929
(6-fluoro-2-methylquinolin-3-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 46978929) has the molecular formula C19H23FN4O4S and a molecular weight of 422.48 g/mol. Its IUPAC name is (6-fluoro-2-methylquinolin-3-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (6-fluoro-2-methylquinolin-3-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 46978929 |
| Molecular Formula | C19H23FN4O4S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (6-fluoro-2-methylquinolin-3-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cc1nc2ccc(F)cc2cc1C(=O)N1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H23FN4O4S/c1-14-17(13-15-12-16(20)2-3-18(15)21-14)19(25)22-4-6-23(7-5-22)29(26,27)24-8-10-28-11-9-24/h2-3,12-13H,4-11H2,1H3 |
| InChIKey | XZWQWXUDMTXLNJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |