C11H9FN2O — CID 945082
6-fluoro-2-methylquinoline-3-carboxamide (PubChem CID 945082) has the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. Its IUPAC name is 6-fluoro-2-methylquinoline-3-carboxamide.
| Compound Name | 6-fluoro-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 945082 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-fluoro-2-methylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccc(F)cc2cc1C(N)=O |
| InChI | InChI=1S/C11H9FN2O/c1-6-9(11(13)15)5-7-4-8(12)2-3-10(7)14-6/h2-5H,1H3,(H2,13,15) |
| InChIKey | PCPZODDPXFFONW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |