C16H11ClFN3O — CID 4732180
N-(5-chloro-2-pyridinyl)-6-fluoro-2-methylquinoline-3-carboxamide (PubChem CID 4732180) has the molecular formula C16H11ClFN3O and a molecular weight of 315.74 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-6-fluoro-2-methylquinoline-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-6-fluoro-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4732180 |
| Molecular Formula | C16H11ClFN3O |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-6-fluoro-2-methylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccc(F)cc2cc1C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H11ClFN3O/c1-9-13(7-10-6-12(18)3-4-14(10)20-9)16(22)21-15-5-2-11(17)8-19-15/h2-8H,1H3,(H,19,21,22) |
| InChIKey | YTAHTWXXVRKOFE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |