C17H10ClF2N5O2 — CID 21072666
N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-5-fluoropyrimidine-2-carboxamide (PubChem CID 21072666) has the molecular formula C17H10ClF2N5O2 and a molecular weight of 389.75 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-5-fluoropyrimidine-2-carboxamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-5-fluoropyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 21072666 |
| Molecular Formula | C17H10ClF2N5O2 |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-5-fluoropyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1C(=O)Nc1ccc(Cl)cn1)c1ncc(F)cn1 |
| InChI | InChI=1S/C17H10ClF2N5O2/c18-9-1-4-14(21-6-9)25-16(26)12-5-10(19)2-3-13(12)24-17(27)15-22-7-11(20)8-23-15/h1-8H,(H,24,27)(H,21,25,26) |
| InChIKey | ROOZYWKVVNZTNQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |