C14H21N3O5S — CID 38458239
(3-methylfuran-2-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 38458239) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (3-methylfuran-2-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 38458239 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3-methylfuran-2-yl)-(4-morpholin-4-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C14H21N3O5S/c1-12-2-9-22-13(12)14(18)15-3-5-16(6-4-15)23(19,20)17-7-10-21-11-8-17/h2,9H,3-8,10-11H2,1H3 |
| InChIKey | VRKXEJJQHJARNB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |