C12H16N2O3 — CID 32823446
1-(3-methylfuran-2-carbonyl)piperidine-4-carboxamide (PubChem CID 32823446) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(3-methylfuran-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-methylfuran-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 32823446 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(3-methylfuran-2-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1ccoc1C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C12H16N2O3/c1-8-4-7-17-10(8)12(16)14-5-2-9(3-6-14)11(13)15/h4,7,9H,2-3,5-6H2,1H3,(H2,13,15) |
| InChIKey | QVRYHTXJNNSSQD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |