C15H22N2O3 — CID 98894959
[(4aS,8aS)-4-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 98894959) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(4aS,8aS)-4-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [(4aS,8aS)-4-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 98894959 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [(4aS,8aS)-4-ethyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | CCN1CCO[C@H]2CCN(C(=O)c3occc3C)C[C@@H]21 |
| InChI | InChI=1S/C15H22N2O3/c1-3-16-7-9-19-13-4-6-17(10-12(13)16)15(18)14-11(2)5-8-20-14/h5,8,12-13H,3-4,6-7,9-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | KQXXUAOIWSVLOD-STQMWFEESA-N |
| XLogP | 1.52 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |