C16H24N2O3 — CID 98895065
[(4aS,8aS)-4-propan-2-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylfuran-3-yl)methanone (PubChem CID 98895065) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(4aS,8aS)-4-propan-2-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylfuran-3-yl)methanone.
| Compound Name | [(4aS,8aS)-4-propan-2-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 98895065 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [(4aS,8aS)-4-propan-2-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylfuran-3-yl)methanone |
| SMILES | Cc1occc1C(=O)N1CC[C@@H]2OCCN(C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)18-7-9-21-15-4-6-17(10-14(15)18)16(19)13-5-8-20-12(13)3/h5,8,11,14-15H,4,6-7,9-10H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | GYBZOKHAMAJSHS-GJZGRUSLSA-N |
| XLogP | 1.91 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |