C11H12N2O3 — CID 78945652
4-(2-methylfuran-3-carbonyl)morpholine-2-carbonitrile (PubChem CID 78945652) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 4-(2-methylfuran-3-carbonyl)morpholine-2-carbonitrile.
| Compound Name | 4-(2-methylfuran-3-carbonyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 78945652 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-(2-methylfuran-3-carbonyl)morpholine-2-carbonitrile |
| SMILES | Cc1occc1C(=O)N1CCOC(C#N)C1 |
| InChI | InChI=1S/C11H12N2O3/c1-8-10(2-4-15-8)11(14)13-3-5-16-9(6-12)7-13/h2,4,9H,3,5,7H2,1H3 |
| InChIKey | MCMRQSMALOJKJK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |