C12H12N2O4 — CID 103892457
4-(2,4-dihydroxybenzoyl)morpholine-2-carbonitrile (PubChem CID 103892457) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 4-(2,4-dihydroxybenzoyl)morpholine-2-carbonitrile.
| Compound Name | 4-(2,4-dihydroxybenzoyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 103892457 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(2,4-dihydroxybenzoyl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(C(=O)c2ccc(O)cc2O)CCO1 |
| InChI | InChI=1S/C12H12N2O4/c13-6-9-7-14(3-4-18-9)12(17)10-2-1-8(15)5-11(10)16/h1-2,5,9,15-16H,3-4,7H2 |
| InChIKey | OPCYSDKMVQSCTF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |