C13H12F2N2O2 — CID 82814599
4-(2,6-difluoro-3-methylbenzoyl)morpholine-2-carbonitrile (PubChem CID 82814599) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-methylbenzoyl)morpholine-2-carbonitrile.
| Compound Name | 4-(2,6-difluoro-3-methylbenzoyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 82814599 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(2,6-difluoro-3-methylbenzoyl)morpholine-2-carbonitrile |
| SMILES | Cc1ccc(F)c(C(=O)N2CCOC(C#N)C2)c1F |
| InChI | InChI=1S/C13H12F2N2O2/c1-8-2-3-10(14)11(12(8)15)13(18)17-4-5-19-9(6-16)7-17/h2-3,9H,4-5,7H2,1H3 |
| InChIKey | GOPACPCCIFSCFL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |