C20H28N4O3S — CID 41469728
4-(2,6-dimethylquinoline-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 41469728) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-(2,6-dimethylquinoline-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-(2,6-dimethylquinoline-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 41469728 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-(2,6-dimethylquinoline-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)c2cc3cc(C)ccc3nc2C)CC1 |
| InChI | InChI=1S/C20H28N4O3S/c1-5-23(6-2)28(26,27)24-11-9-22(10-12-24)20(25)18-14-17-13-15(3)7-8-19(17)21-16(18)4/h7-8,13-14H,5-6,9-12H2,1-4H3 |
| InChIKey | XQPXZZUPNANNDK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |