C14H20Cl2N4O3S — CID 47078827
4-(2,6-dichloropyridine-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 47078827) has the molecular formula C14H20Cl2N4O3S and a molecular weight of 395.31 g/mol. Its IUPAC name is 4-(2,6-dichloropyridine-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-(2,6-dichloropyridine-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 47078827 |
| Molecular Formula | C14H20Cl2N4O3S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 4-(2,6-dichloropyridine-3-carbonyl)-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)c2ccc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C14H20Cl2N4O3S/c1-3-19(4-2)24(22,23)20-9-7-18(8-10-20)14(21)11-5-6-12(15)17-13(11)16/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | BWCSDFYCJYIRSD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|