C24H28N4O3S — CID 24584448
N,N-diethyl-4-(2-phenylquinoline-4-carbonyl)piperazine-1-sulfonamide (PubChem CID 24584448) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N,N-diethyl-4-(2-phenylquinoline-4-carbonyl)piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-(2-phenylquinoline-4-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 24584448 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N,N-diethyl-4-(2-phenylquinoline-4-carbonyl)piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)c2cc(-c3ccccc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H28N4O3S/c1-3-27(4-2)32(30,31)28-16-14-26(15-17-28)24(29)21-18-23(19-10-6-5-7-11-19)25-22-13-9-8-12-20(21)22/h5-13,18H,3-4,14-17H2,1-2H3 |
| InChIKey | MLSKXTFEALNKOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |