C19H24N4O5S — CID 46979096
1-methyl-4-(4-morpholin-4-ylsulfonylpiperazine-1-carbonyl)quinolin-2-one (PubChem CID 46979096) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-methyl-4-(4-morpholin-4-ylsulfonylpiperazine-1-carbonyl)quinolin-2-one.
| Compound Name | 1-methyl-4-(4-morpholin-4-ylsulfonylpiperazine-1-carbonyl)quinolin-2-one |
|---|---|
| PubChem CID | 46979096 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-methyl-4-(4-morpholin-4-ylsulfonylpiperazine-1-carbonyl)quinolin-2-one |
| SMILES | Cn1c(=O)cc(C(=O)N2CCN(S(=O)(=O)N3CCOCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H24N4O5S/c1-20-17-5-3-2-4-15(17)16(14-18(20)24)19(25)21-6-8-22(9-7-21)29(26,27)23-10-12-28-13-11-23/h2-5,14H,6-13H2,1H3 |
| InChIKey | WEHNUFAWPGZYCS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |