C19H17ClFNO2 — CID 111696825
4-(4-chlorophenyl)-2-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide (PubChem CID 111696825) has the molecular formula C19H17ClFNO2 and a molecular weight of 345.80 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide.
| Compound Name | 4-(4-chlorophenyl)-2-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide |
|---|---|
| PubChem CID | 111696825 |
| Molecular Formula | C19H17ClFNO2 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccc(-c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C19H17ClFNO2/c20-15-5-2-13(3-6-15)14-4-8-17(18(21)10-14)19(24)22-16-7-1-12(9-16)11-23/h1-8,10,12,16,23H,9,11H2,(H,22,24)/t12-,16+/m0/s1 |
| InChIKey | GAKQTXJCXSIFAF-BLLLJJGKSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|