C16H17F2NO2 — CID 111697111
2-(2,5-difluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide (PubChem CID 111697111) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2,5-difluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 111697111 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)C1CC1c1cc(F)ccc1F |
| InChI | InChI=1S/C16H17F2NO2/c17-10-2-4-15(18)13(6-10)12-7-14(12)16(21)19-11-3-1-9(5-11)8-20/h1-4,6,9,11-12,14,20H,5,7-8H2,(H,19,21)/t9-,11+,12?,14?/m0/s1 |
| InChIKey | MCBALYOGSNRFRC-CGPVLUSTSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|