C15H14FNO3 — CID 111697167
5-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide (PubChem CID 111697167) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 5-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111697167 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 5-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C15H14FNO3/c16-11-2-4-13-10(6-11)7-14(20-13)15(19)17-12-3-1-9(5-12)8-18/h1-4,6-7,9,12,18H,5,8H2,(H,17,19)/t9-,12+/m0/s1 |
| InChIKey | ZSAFOKIICAPWOA-JOYOIKCWSA-N |
| XLogP | 2.24 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|