C14H18N2O2 — CID 132970516
4-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyridine-2-carboxamide (PubChem CID 132970516) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyridine-2-carboxamide.
| Compound Name | 4-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 132970516 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]pyridine-2-carboxamide |
| SMILES | CCc1ccnc(C(=O)N[C@@H]2C=C[C@H](CO)C2)c1 |
| InChI | InChI=1S/C14H18N2O2/c1-2-10-5-6-15-13(8-10)14(18)16-12-4-3-11(7-12)9-17/h3-6,8,11-12,17H,2,7,9H2,1H3,(H,16,18)/t11-,12+/m0/s1 |
| InChIKey | WPLZBSAQBYZSCS-NWDGAFQWSA-N |
| XLogP | 1.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|