C14H15N3O2 — CID 111697069
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 111697069) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 111697069 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C14H15N3O2/c18-7-9-1-3-11(5-9)17-14(19)10-2-4-12-13(6-10)16-8-15-12/h1-4,6,8-9,11,18H,5,7H2,(H,15,16)(H,17,19)/t9-,11+/m0/s1 |
| InChIKey | GQLWHHSOBKAICF-GXSJLCMTSA-N |
| XLogP | 1.23 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|