C8H13NO2V — CID 162196806
N-[4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide;vanadium (PubChem CID 162196806) has the molecular formula C8H13NO2V and a molecular weight of 206.14 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide;vanadium.
| Compound Name | N-[4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide;vanadium |
|---|---|
| PubChem CID | 162196806 |
| Molecular Formula | C8H13NO2V |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | N-[4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide;vanadium |
| SMILES | CC(=O)NC1C=CC(CO)C1.[V] |
| InChI | InChI=1S/C8H13NO2.V/c1-6(11)9-8-3-2-7(4-8)5-10;/h2-3,7-8,10H,4-5H2,1H3,(H,9,11); |
| InChIKey | ZRAXPMNJIPTTAK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|