C15H19NO2S — CID 111661460
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 111661460) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 111661460 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)N[C@@H]2C=C[C@H](CO)C2)cc1 |
| InChI | InChI=1S/C15H19NO2S/c1-11-2-6-14(7-3-11)19-10-15(18)16-13-5-4-12(8-13)9-17/h2-7,12-13,17H,8-10H2,1H3,(H,16,18)/t12-,13+/m0/s1 |
| InChIKey | LTWJQCCMVBMUCZ-QWHCGFSZSA-N |
| XLogP | 2.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|