C15H23N3O2S — CID 75435050
2-(1-tert-butylimidazol-2-yl)sulfanyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide (PubChem CID 75435050) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-(1-tert-butylimidazol-2-yl)sulfanyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide.
| Compound Name | 2-(1-tert-butylimidazol-2-yl)sulfanyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 75435050 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(1-tert-butylimidazol-2-yl)sulfanyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
| SMILES | CC(C)(C)n1ccnc1SCC(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-15(2,3)18-7-6-16-14(18)21-10-13(20)17-12-5-4-11(8-12)9-19/h4-7,11-12,19H,8-10H2,1-3H3,(H,17,20)/t11-,12+/m0/s1 |
| InChIKey | KCDRXLOAGLCZJG-NWDGAFQWSA-N |
| XLogP | 1.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|