C17H19N3O2 — CID 111661620
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 111661620) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111661620 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c21-12-14-4-7-16(10-14)19-17(22)15-5-2-13(3-6-15)11-20-9-1-8-18-20/h1-9,14,16,21H,10-12H2,(H,19,22)/t14-,16+/m0/s1 |
| InChIKey | WNPDGTBWHIIQQR-GOEBONIOSA-N |
| XLogP | 1.60 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|