C15H17N3O3S — CID 18137645
N-(1,1-dioxothiolan-3-yl)-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 18137645) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18137645 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c19-15(17-14-6-9-22(20,21)11-14)13-4-2-12(3-5-13)10-18-8-1-7-16-18/h1-5,7-8,14H,6,9-11H2,(H,17,19) |
| InChIKey | QIIKOLFGIOEMKS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |