C9H13N3O3S — CID 110689965
N-(1,1-dioxothiolan-3-yl)-2-pyrazol-1-ylacetamide (PubChem CID 110689965) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-pyrazol-1-ylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 110689965 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-pyrazol-1-ylacetamide |
| SMILES | O=C(Cn1cccn1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13N3O3S/c13-9(6-12-4-1-3-10-12)11-8-2-5-16(14,15)7-8/h1,3-4,8H,2,5-7H2,(H,11,13) |
| InChIKey | LBUJMXKLBTZOGS-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |