C13H15N3O3S2 — CID 95153748
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3-thiophen-3-ylpyrazol-1-yl)acetamide (PubChem CID 95153748) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3-thiophen-3-ylpyrazol-1-yl)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3-thiophen-3-ylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 95153748 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(3-thiophen-3-ylpyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccc(-c2ccsc2)n1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15N3O3S2/c17-13(14-11-3-6-21(18,19)9-11)7-16-4-1-12(15-16)10-2-5-20-8-10/h1-2,4-5,8,11H,3,6-7,9H2,(H,14,17)/t11-/m0/s1 |
| InChIKey | VLQKLYHNXZNFSC-NSHDSACASA-N |
| XLogP | 0.91 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |