C11H17N3O3S — CID 45148400
2-(3,5-dimethylpyrazol-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 45148400) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 45148400 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C11H17N3O3S/c1-8-5-9(2)14(13-8)6-11(15)12-10-3-4-18(16,17)7-10/h5,10H,3-4,6-7H2,1-2H3,(H,12,15) |
| InChIKey | OARGNJLUQLVOBP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |