C12H21N3O2S — CID 113220131
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,1-dioxothiolan-3-amine (PubChem CID 113220131) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 113220131 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,1-dioxothiolan-3-amine |
| SMILES | Cc1cc(C)n(CCCNC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C12H21N3O2S/c1-10-8-11(2)15(14-10)6-3-5-13-12-4-7-18(16,17)9-12/h8,12-13H,3-7,9H2,1-2H3 |
| InChIKey | BQAMLXAWHXEUOY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|