C13H24N4 — CID 114536325
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperidin-3-amine (PubChem CID 114536325) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperidin-3-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperidin-3-amine |
|---|---|
| PubChem CID | 114536325 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperidin-3-amine |
| SMILES | Cc1cc(C)n(CCCNC2CCCNC2)n1 |
| InChI | InChI=1S/C13H24N4/c1-11-9-12(2)17(16-11)8-4-7-15-13-5-3-6-14-10-13/h9,13-15H,3-8,10H2,1-2H3 |
| InChIKey | PFXNESPFTSXHSN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|