C18H25N3 — CID 115706685
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115706685) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115706685 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Cc1cc(C)n(CCCNC2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C18H25N3/c1-14-13-15(2)21(20-14)12-6-11-19-18-10-5-8-16-7-3-4-9-17(16)18/h3-4,7,9,13,18-19H,5-6,8,10-12H2,1-2H3 |
| InChIKey | NHFIUEYPUJQDPF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|